Difference between revisions of "CPD-12724"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19167 == * common-name: ** 3-oxo-(7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...") |
(Created page with "Category:metabolite == Metabolite TAGATOSE-1-6-DIPHOSPHATE == * common-name: ** d-tagatofuranose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite TAGATOSE-1-6-DIPHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** d-tagatofuranose 1,6-bisphosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rnbgygvwrkecfj-oexcpvawsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 336.085 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[TAGAALDOL-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[TAGAKIN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-tagatofuranose 1,6-bisphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rnbgygvwrkecfj-oexcpvawsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=336.085}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite TAGATOSE-1-6-DIPHOSPHATE
- common-name:
- d-tagatofuranose 1,6-bisphosphate
- smiles:
- c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
- inchi-key:
- rnbgygvwrkecfj-oexcpvawsa-j
- molecular-weight:
- 336.085