Difference between revisions of "CPD-12724"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HSCN == * common-name: ** thiocyanate * smiles: ** c(#n)[s-] * inchi-key: ** zmzdmbwjuhkjps-uhfffaoysa-m * molecular-weight: ** 58.078 ==...")
(Created page with "Category:metabolite == Metabolite CPD-12724 == * common-name: ** baicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3))) * inchi-key: ** fxnfhkrtjbstcs...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HSCN ==
+
== Metabolite CPD-12724 ==
 
* common-name:
 
* common-name:
** thiocyanate
+
** baicalein
 
* smiles:
 
* smiles:
** c(#n)[s-]
+
** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3)))
 
* inchi-key:
 
* inchi-key:
** zmzdmbwjuhkjps-uhfffaoysa-m
+
** fxnfhkrtjbstcs-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 58.078
+
** 270.241
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14240]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-6359]]
 
* [[THIOSULFATE-SULFURTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiocyanate}}
+
{{#set: common-name=baicalein}}
{{#set: inchi-key=inchikey=zmzdmbwjuhkjps-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=fxnfhkrtjbstcs-uhfffaoysa-n}}
{{#set: molecular-weight=58.078}}
+
{{#set: molecular-weight=270.241}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-12724

  • common-name:
    • baicalein
  • smiles:
    • c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3)))
  • inchi-key:
    • fxnfhkrtjbstcs-uhfffaoysa-n
  • molecular-weight:
    • 270.241

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality