Difference between revisions of "CPD-12724"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HSCN == * common-name: ** thiocyanate * smiles: ** c(#n)[s-] * inchi-key: ** zmzdmbwjuhkjps-uhfffaoysa-m * molecular-weight: ** 58.078 ==...")
(Created page with "Category:metabolite == Metabolite D-HEXOSE-6-PHOSPHATE == * common-name: ** d-hexose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** nbs...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HSCN ==
+
== Metabolite D-HEXOSE-6-PHOSPHATE ==
 
* common-name:
 
* common-name:
** thiocyanate
+
** d-hexose 6-phosphate
 
* smiles:
 
* smiles:
** c(#n)[s-]
+
** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** zmzdmbwjuhkjps-uhfffaoysa-m
+
** nbschqhzlsjfnq-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 58.078
+
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-6359]]
+
* [[HEXOKINASE-RXN]]
* [[THIOSULFATE-SULFURTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiocyanate}}
+
{{#set: common-name=d-hexose 6-phosphate}}
{{#set: inchi-key=inchikey=zmzdmbwjuhkjps-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-uhfffaoysa-l}}
{{#set: molecular-weight=58.078}}
+
{{#set: molecular-weight=258.121}}

Revision as of 13:09, 14 January 2021

Metabolite D-HEXOSE-6-PHOSPHATE

  • common-name:
    • d-hexose 6-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • nbschqhzlsjfnq-uhfffaoysa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality