Difference between revisions of "CPD-12777"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10664 == * transcription-direction: ** negative * right-end-position: ** 214803 * left-end-position: ** 203904 * centisome-position: ** 25.872793...") |
(Created page with "Category:metabolite == Metabolite CPD-12777 == * common-name: ** (3r)-hydroxydecanoyl-coa * smiles: ** cccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-]...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12777 == |
− | * | + | * common-name: |
− | ** | + | ** (3r)-hydroxydecanoyl-coa |
− | * | + | * smiles: |
− | ** | + | ** cccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o |
− | * | + | * inchi-key: |
− | ** | + | ** hivsmyzamunfkz-dulmrfqqsa-j |
− | * | + | * molecular-weight: |
− | ** | + | ** 933.753 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14805]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[RXN- | + | * [[RXN-11797]] |
− | + | * [[RXN-14805]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[RXN- | + | {{#set: common-name=(3r)-hydroxydecanoyl-coa}} |
− | + | {{#set: inchi-key=inchikey=hivsmyzamunfkz-dulmrfqqsa-j}} | |
− | + | {{#set: molecular-weight=933.753}} | |
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-12777
- common-name:
- (3r)-hydroxydecanoyl-coa
- smiles:
- cccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
- inchi-key:
- hivsmyzamunfkz-dulmrfqqsa-j
- molecular-weight:
- 933.753