Difference between revisions of "CPD-12777"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHO-ENOL-PYRUVATE == * common-name: ** phosphoenolpyruvate * smiles: ** c=c(op([o-])([o-])=o)c([o-])=o * inchi-key: ** dtbnbxwjwcwcik...") |
(Created page with "Category:metabolite == Metabolite BCCP-biotin-L-lysine == * common-name: ** a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine == Reaction(s) known to consume the comp...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BCCP-biotin-L-lysine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[BIOTINLIG-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine}} |
| − | |||
| − | |||
Revision as of 18:53, 14 January 2021
Contents
Metabolite BCCP-biotin-L-lysine
- common-name:
- a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
