Difference between revisions of "CPD-12826"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Ubiquitin-C-Terminal-Glycine == * common-name: ** a [ubiquitin] c-terminal glycine == Reaction(s) known to consume the compound == * UB...") |
(Created page with "Category:metabolite == Metabolite CPD-12826 == * common-name: ** folate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) * inch...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-12826 == |
* common-name: | * common-name: | ||
− | ** | + | ** folate |
+ | * smiles: | ||
+ | ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) | ||
+ | * inchi-key: | ||
+ | ** ovbpiulpvideao-lbprgkrzsa-l | ||
+ | * molecular-weight: | ||
+ | ** 439.387 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DHFOR]] |
+ | * [[FOLR2]] | ||
+ | * [[THFOR1]] | ||
+ | * [[THFOR2]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=folate}} |
+ | {{#set: inchi-key=inchikey=ovbpiulpvideao-lbprgkrzsa-l}} | ||
+ | {{#set: molecular-weight=439.387}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-12826
- common-name:
- folate
- smiles:
- c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3))
- inchi-key:
- ovbpiulpvideao-lbprgkrzsa-l
- molecular-weight:
- 439.387