Difference between revisions of "CPD-12826"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9904 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=...") |
(Created page with "Category:metabolite == Metabolite CPD-12826 == * common-name: ** folate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) * inch...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12826 == |
* common-name: | * common-name: | ||
| − | ** | + | ** folate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ovbpiulpvideao-lbprgkrzsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 439.387 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DHFOR]] | ||
| + | * [[FOLR2]] | ||
| + | * [[THFOR1]] | ||
| + | * [[THFOR2]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=folate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ovbpiulpvideao-lbprgkrzsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=439.387}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-12826
- common-name:
- folate
- smiles:
- c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3))
- inchi-key:
- ovbpiulpvideao-lbprgkrzsa-l
- molecular-weight:
- 439.387
