Difference between revisions of "CPD-12829"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite R-3-Hydroxypalmitoyl-ACPs == * common-name: ** a (3r)-3-hydroxypalmitoyl-[acp] == Reaction(s) known to consume the compound == * 4.2.1....") |
(Created page with "Category:metabolite == Metabolite CPD-12829 == * common-name: ** plastoquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12829 == |
* common-name: | * common-name: | ||
| − | ** | + | ** plastoquinol-9 |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(=c1o)c)c)o))c)c)c | ||
| + | * inchi-key: | ||
| + | ** ijbljlrewplepb-iqsnhbbhsa-n | ||
| + | * molecular-weight: | ||
| + | ** 751.23 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-2762]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=plastoquinol-9}} |
| + | {{#set: inchi-key=inchikey=ijbljlrewplepb-iqsnhbbhsa-n}} | ||
| + | {{#set: molecular-weight=751.23}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-12829
- common-name:
- plastoquinol-9
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(=c1o)c)c)o))c)c)c
- inchi-key:
- ijbljlrewplepb-iqsnhbbhsa-n
- molecular-weight:
- 751.23
