Difference between revisions of "CPD-12850"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11281 == * common-name: ** s-sulfanylglutathione * smiles: ** c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key: ** qbolvl...") |
(Created page with "Category:metabolite == Metabolite CPD-12850 == * common-name: ** 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol * inchi-key: ** xzeuytksayn...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-12850 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol |
− | |||
− | |||
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xzeuytksaynypk-wxpwfurysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 412.698 |
+ | * smiles: | ||
+ | ** cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@]4(c)([c@h]1(cc[c@@h]5([c@h](c)[c@@h](o)cc[c@@]2(c[c@@]12cc[c@](c)34)5)))) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-11876]] | |
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-21831]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xzeuytksaynypk-wxpwfurysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=412.698}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-12850
- common-name:
- 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol
- inchi-key:
- xzeuytksaynypk-wxpwfurysa-n
- molecular-weight:
- 412.698
- smiles:
- cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@]4(c)([c@h]1(cc[c@@h]5([c@h](c)[c@@h](o)cc[c@@]2(c[c@@]12cc[c@](c)34)5))))