Difference between revisions of "CPD-12850"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11281 == * common-name: ** s-sulfanylglutathione * smiles: ** c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key: ** qbolvl...")
(Created page with "Category:metabolite == Metabolite CPD-12850 == * common-name: ** 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol * inchi-key: ** xzeuytksayn...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11281 ==
+
== Metabolite CPD-12850 ==
 
* common-name:
 
* common-name:
** s-sulfanylglutathione
+
** 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol
* smiles:
 
** c(ss)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
 
* inchi-key:
 
* inchi-key:
** qbolvlbsugjhgb-wdskdsinsa-m
+
** xzeuytksaynypk-wxpwfurysa-n
 
* molecular-weight:
 
* molecular-weight:
** 338.373
+
** 412.698
 +
* smiles:
 +
** cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@]4(c)([c@h]1(cc[c@@h]5([c@h](c)[c@@h](o)cc[c@@]2(c[c@@]12cc[c@](c)34)5))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FESGSHTHIO-RXN]]
+
* [[RXN-11876]]
* [[RXN-13161]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-21831]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-sulfanylglutathione}}
+
{{#set: common-name=4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol}}
{{#set: inchi-key=inchikey=qbolvlbsugjhgb-wdskdsinsa-m}}
+
{{#set: inchi-key=inchikey=xzeuytksaynypk-wxpwfurysa-n}}
{{#set: molecular-weight=338.373}}
+
{{#set: molecular-weight=412.698}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-12850

  • common-name:
    • 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol
  • inchi-key:
    • xzeuytksaynypk-wxpwfurysa-n
  • molecular-weight:
    • 412.698
  • smiles:
    • cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@]4(c)([c@h]1(cc[c@@h]5([c@h](c)[c@@h](o)cc[c@@]2(c[c@@]12cc[c@](c)34)5))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality