Difference between revisions of "CPD-12850"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-ubi-N-term-specific-UCP-E2-L-cysteine == * common-name: ** an [n-terminal e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine ==...")
(Created page with "Category:metabolite == Metabolite CPD-6661 == * common-name: ** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-ubi-N-term-specific-UCP-E2-L-cysteine ==
+
== Metabolite CPD-6661 ==
 
* common-name:
 
* common-name:
** an [n-terminal e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine
+
** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate
 +
* smiles:
 +
** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 +
* inchi-key:
 +
** ctpqaxvnygzuaj-qwbqgljisa-d
 +
* molecular-weight:
 +
** 569.977
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15564]]
+
* [[RXN-7186]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15563]]
+
* [[RXN-7186]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an [n-terminal e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine}}
+
{{#set: common-name=1d-myo-inositol (1,2,3,4,6)-pentakisphosphate}}
 +
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-qwbqgljisa-d}}
 +
{{#set: molecular-weight=569.977}}

Revision as of 13:09, 14 January 2021

Metabolite CPD-6661

  • common-name:
    • 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate
  • smiles:
    • c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
  • inchi-key:
    • ctpqaxvnygzuaj-qwbqgljisa-d
  • molecular-weight:
    • 569.977

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality