Difference between revisions of "CPD-12860"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3Z-PHYTOCHROMOBILIN == * common-name: ** (3z)-phytochromobilin * smiles: ** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)...") |
(Created page with "Category:metabolite == Metabolite CPD-10664 == * common-name: ** 5-methylsalicylate * smiles: ** cc1(=cc(=c(c=c1)o)c([o-])=o) * inchi-key: ** dlgbegbhxsaqoc-uhfffaoysa-m *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-10664 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-methylsalicylate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(=cc(=c(c=c1)o)c([o-])=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dlgbegbhxsaqoc-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 151.141 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10079]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-methylsalicylate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dlgbegbhxsaqoc-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=151.141}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite CPD-10664
- common-name:
- 5-methylsalicylate
- smiles:
- cc1(=cc(=c(c=c1)o)c([o-])=o)
- inchi-key:
- dlgbegbhxsaqoc-uhfffaoysa-m
- molecular-weight:
- 151.141
