Difference between revisions of "CPD-12897"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1823 == * common-name: ** nπ-methyl-l-histidine * smiles: ** cn1(c=nc=c1cc(c(=o)[o-])[n+]) * inchi-key: ** jdhildinmrgule-lurjtmie...") |
(Created page with "Category:metabolite == Metabolite CPD-12897 == * common-name: ** 7-methyl-3-oxooct-6-enoyl-coa * smiles: ** cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12897 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7-methyl-3-oxooct-6-enoyl-coa |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lpmixvanmseery-fueukbnzsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 915.695 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11917]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7-methyl-3-oxooct-6-enoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lpmixvanmseery-fueukbnzsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=915.695}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-12897
- common-name:
- 7-methyl-3-oxooct-6-enoyl-coa
- smiles:
- cc(c)=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- lpmixvanmseery-fueukbnzsa-j
- molecular-weight:
- 915.695
