Difference between revisions of "CPD-12902"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == * common-name: ** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine * smiles: ** cc(=o)nc2(...") |
(Created page with "Category:metabolite == Metabolite CPD-12902 == * common-name: ** 5-methylhex-4-enoyl-coa * smiles: ** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12902 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-methylhex-4-enoyl-coa |
* smiles: | * smiles: | ||
| − | ** cc(=o) | + | ** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** beyylhumfmwplh-svhodsnwsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 873.658 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-11917]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-methylhex-4-enoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=beyylhumfmwplh-svhodsnwsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=873.658}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-12902
- common-name:
- 5-methylhex-4-enoyl-coa
- smiles:
- cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- beyylhumfmwplh-svhodsnwsa-j
- molecular-weight:
- 873.658
