Difference between revisions of "CPD-12904"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SELENATE == * common-name: ** selenate * smiles: ** o=[se](=o)([o-])[o-] * inchi-key: ** qyhfivbsnowocq-uhfffaoysa-l * molecular-weight:...") |
(Created page with "Category:metabolite == Metabolite SACCHAROPINE == * common-name: ** l-saccharopine * smiles: ** c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o * inchi-key: ** zdgjahtzv...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SACCHAROPINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-saccharopine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zdgjahtzvhvlot-yumqzzprsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 275.281 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[1.5.1.9-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-saccharopine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zdgjahtzvhvlot-yumqzzprsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=275.281}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite SACCHAROPINE
- common-name:
- l-saccharopine
- smiles:
- c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o
- inchi-key:
- zdgjahtzvhvlot-yumqzzprsa-m
- molecular-weight:
- 275.281
