Difference between revisions of "CPD-12904"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SELENATE == * common-name: ** selenate * smiles: ** o=[se](=o)([o-])[o-] * inchi-key: ** qyhfivbsnowocq-uhfffaoysa-l * molecular-weight:...") |
(Created page with "Category:metabolite == Metabolite CPD-12904 == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * smiles: ** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12904 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2e)-5-methylhexa-2,4-dienoyl-coa |
* smiles: | * smiles: | ||
| − | ** o=[ | + | ** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ifmyvrqehqtins-meoyllpmsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 871.642 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11919]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ifmyvrqehqtins-meoyllpmsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=871.642}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-12904
- common-name:
- (2e)-5-methylhexa-2,4-dienoyl-coa
- smiles:
- cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- ifmyvrqehqtins-meoyllpmsa-j
- molecular-weight:
- 871.642
