Difference between revisions of "CPD-12904"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SACCHAROPINE == * common-name: ** l-saccharopine * smiles: ** c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o * inchi-key: ** zdgjahtzv...")
(Created page with "Category:metabolite == Metabolite CPD-12904 == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * smiles: ** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SACCHAROPINE ==
+
== Metabolite CPD-12904 ==
 
* common-name:
 
* common-name:
** l-saccharopine
+
** (2e)-5-methylhexa-2,4-dienoyl-coa
 
* smiles:
 
* smiles:
** c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o
+
** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** zdgjahtzvhvlot-yumqzzprsa-m
+
** ifmyvrqehqtins-meoyllpmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 275.281
+
** 871.642
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.5.1.9-RXN]]
+
* [[RXN-11919]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-saccharopine}}
+
{{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa}}
{{#set: inchi-key=inchikey=zdgjahtzvhvlot-yumqzzprsa-m}}
+
{{#set: inchi-key=inchikey=ifmyvrqehqtins-meoyllpmsa-j}}
{{#set: molecular-weight=275.281}}
+
{{#set: molecular-weight=871.642}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-12904

  • common-name:
    • (2e)-5-methylhexa-2,4-dienoyl-coa
  • smiles:
    • cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ifmyvrqehqtins-meoyllpmsa-j
  • molecular-weight:
    • 871.642

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality