Difference between revisions of "CPD-12904"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-DEHYDRO-SHIKIMATE == * common-name: ** 3-dehydroshikimate * smiles: ** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1) * inchi-key: ** slwwjzmphjjoph-...")
(Created page with "Category:metabolite == Metabolite CPD-12904 == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * smiles: ** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-DEHYDRO-SHIKIMATE ==
+
== Metabolite CPD-12904 ==
 
* common-name:
 
* common-name:
** 3-dehydroshikimate
+
** (2e)-5-methylhexa-2,4-dienoyl-coa
 
* smiles:
 
* smiles:
** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1)
+
** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** slwwjzmphjjoph-phdidxhhsa-m
+
** ifmyvrqehqtins-meoyllpmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 171.129
+
** 871.642
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
* [[RXN-11919]]
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
 
* [[RXN-7968]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-dehydroshikimate}}
+
{{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa}}
{{#set: inchi-key=inchikey=slwwjzmphjjoph-phdidxhhsa-m}}
+
{{#set: inchi-key=inchikey=ifmyvrqehqtins-meoyllpmsa-j}}
{{#set: molecular-weight=171.129}}
+
{{#set: molecular-weight=871.642}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-12904

  • common-name:
    • (2e)-5-methylhexa-2,4-dienoyl-coa
  • smiles:
    • cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ifmyvrqehqtins-meoyllpmsa-j
  • molecular-weight:
    • 871.642

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality