Difference between revisions of "CPD-12904"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-352 == * common-name: ** 17β-estradiol * smiles: ** cc12([ch](ccc(o)1)[ch]4([ch](cc2)c3(c(=cc(o)=cc=3)cc4))) * inchi-key: ** vox...") |
(Created page with "Category:metabolite == Metabolite UNDECAPRENYL-DIPHOSPHATE == * common-name: ** di-trans,octa-cis-undecaprenyl diphosphate * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=ccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite UNDECAPRENYL-DIPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** di-trans,octa-cis-undecaprenyl diphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-])c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ntxgvhccxvhycl-ntdveaecsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 924.251 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8999]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=di-trans,octa-cis-undecaprenyl diphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ntxgvhccxvhycl-ntdveaecsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=924.251}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite UNDECAPRENYL-DIPHOSPHATE
- common-name:
- di-trans,octa-cis-undecaprenyl diphosphate
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-])c)c)c
- inchi-key:
- ntxgvhccxvhycl-ntdveaecsa-k
- molecular-weight:
- 924.251
