Difference between revisions of "CPD-12904"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UNDECAPRENYL-DIPHOSPHATE == * common-name: ** di-trans,octa-cis-undecaprenyl diphosphate * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=ccc...")
(Created page with "Category:metabolite == Metabolite Pyrimidine-Nucleosides == * common-name: ** a pyrimidine nucleoside == Reaction(s) known to consume the compound == * RIBOSYLPYRIMIDINE...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UNDECAPRENYL-DIPHOSPHATE ==
+
== Metabolite Pyrimidine-Nucleosides ==
 
* common-name:
 
* common-name:
** di-trans,octa-cis-undecaprenyl diphosphate
+
** a pyrimidine nucleoside
* smiles:
 
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-])c)c)c
 
* inchi-key:
 
** ntxgvhccxvhycl-ntdveaecsa-k
 
* molecular-weight:
 
** 924.251
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RIBOSYLPYRIMIDINE-NUCLEOSIDASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8999]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-trans,octa-cis-undecaprenyl diphosphate}}
+
{{#set: common-name=a pyrimidine nucleoside}}
{{#set: inchi-key=inchikey=ntxgvhccxvhycl-ntdveaecsa-k}}
 
{{#set: molecular-weight=924.251}}
 

Revision as of 15:28, 5 January 2021

Metabolite Pyrimidine-Nucleosides

  • common-name:
    • a pyrimidine nucleoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality