Difference between revisions of "CPD-12905"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13758 == * common-name: ** 3-[(3as,4s,5r,7as)-5-hydroxy-7a-methyl-1-oxo-octahydro-1h-inden-4-yl]-3-oxopropanoyl-coa * smiles: ** cc(c...")
(Created page with "Category:metabolite == Metabolite CPD-3061 == * common-name: ** (2s)-liquiritigenin * smiles: ** c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o) * inchi-key: ** furuxtvzlhccn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13758 ==
+
== Metabolite CPD-3061 ==
 
* common-name:
 
* common-name:
** 3-[(3as,4s,5r,7as)-5-hydroxy-7a-methyl-1-oxo-octahydro-1h-inden-4-yl]-3-oxopropanoyl-coa
+
** (2s)-liquiritigenin
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c(o)ccc2(c)(c(=o)cc[ch]12)))cop(=o)(op(=o)(occ3(c(op([o-])(=o)[o-])c(o)c(o3)n5(c4(=c(c(n)=nc=n4)n=c5))))[o-])[o-]
+
** c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o)
 
* inchi-key:
 
* inchi-key:
** ogahroymeoborv-xongilkksa-j
+
** furuxtvzlhccna-aweznqclsa-n
 
* molecular-weight:
 
* molecular-weight:
** 999.769
+
** 256.257
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12750]]
+
* [[RXN-3221]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-[(3as,4s,5r,7as)-5-hydroxy-7a-methyl-1-oxo-octahydro-1h-inden-4-yl]-3-oxopropanoyl-coa}}
+
{{#set: common-name=(2s)-liquiritigenin}}
{{#set: inchi-key=inchikey=ogahroymeoborv-xongilkksa-j}}
+
{{#set: inchi-key=inchikey=furuxtvzlhccna-aweznqclsa-n}}
{{#set: molecular-weight=999.769}}
+
{{#set: molecular-weight=256.257}}

Revision as of 11:18, 15 January 2021

Metabolite CPD-3061

  • common-name:
    • (2s)-liquiritigenin
  • smiles:
    • c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o)
  • inchi-key:
    • furuxtvzlhccna-aweznqclsa-n
  • molecular-weight:
    • 256.257

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality