Difference between revisions of "CPD-12928"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-EPINEPHRINE == * common-name: ** (r)-adrenaline * smiles: ** c[n+]cc(o)c1(c=cc(=c(c=1)o)o) * inchi-key: ** uctwmzqnuqwslp-vifpvbqesa-o...") |
(Created page with "Category:metabolite == Metabolite CPD-12928 == * common-name: ** 4α-carboxy-5α-cholesta-7,24-dien-3β-ol * inchi-key: ** bwhpoozligphhl-qpcstclvsa-m * mole...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12928 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4α-carboxy-5α-cholesta-7,24-dien-3β-ol |
| − | |||
| − | |||
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bwhpoozligphhl-qpcstclvsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 427.646 |
| + | * smiles: | ||
| + | ** cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@h]4(c1([c@@h]([c@]2(cc[c@h](o)[c@@h](c([o-])=o)[c@h](cc=1)2)(c))cc[c@](c)34))) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-21835]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4α-carboxy-5α-cholesta-7,24-dien-3β-ol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bwhpoozligphhl-qpcstclvsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=427.646}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-12928
- common-name:
- 4α-carboxy-5α-cholesta-7,24-dien-3β-ol
- inchi-key:
- bwhpoozligphhl-qpcstclvsa-m
- molecular-weight:
- 427.646
- smiles:
- cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@h]4(c1([c@@h]([c@]2(cc[c@h](o)[c@@h](c([o-])=o)[c@h](cc=1)2)(c))cc[c@](c)34)))
