Difference between revisions of "CPD-12928"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-EPINEPHRINE == * common-name: ** (r)-adrenaline * smiles: ** c[n+]cc(o)c1(c=cc(=c(c=1)o)o) * inchi-key: ** uctwmzqnuqwslp-vifpvbqesa-o...")
(Created page with "Category:metabolite == Metabolite CPD-7013 == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c5(=n([mg]36(n1(=c(c(cc)=c([ch]=o)c1=cc=2n34)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-EPINEPHRINE ==
+
== Metabolite CPD-7013 ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c5(=n([mg]36(n1(=c(c(cc)=c([ch]=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)c(c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** (r)-adrenaline
+
** geranylgeranyl chlorophyll b
* smiles:
 
** c[n+]cc(o)c1(c=cc(=c(c=1)o)o)
 
* inchi-key:
 
** uctwmzqnuqwslp-vifpvbqesa-o
 
 
* molecular-weight:
 
* molecular-weight:
** 184.214
+
** 901.439
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10908]]
+
* [[RXN-7673]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7673]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-adrenaline}}
+
{{#set: common-name=geranylgeranyl chlorophyll b}}
{{#set: inchi-key=inchikey=uctwmzqnuqwslp-vifpvbqesa-o}}
+
{{#set: molecular-weight=901.439}}
{{#set: molecular-weight=184.214}}
 

Revision as of 14:58, 5 January 2021

Metabolite CPD-7013

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c5(=n([mg]36(n1(=c(c(cc)=c([ch]=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)c(c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • geranylgeranyl chlorophyll b
  • molecular-weight:
    • 901.439

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality