Difference between revisions of "CPD-12928"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P == * common-name: ** phosphoribulosylformimino-aicar-phosphate * smiles: ** c(op(=o)([o-])[o-])c(o)c(o...")
(Created page with "Category:metabolite == Metabolite CPD-10353 == * common-name: ** (r)-acetoin * smiles: ** cc(o)c(=o)c * inchi-key: ** rowkjavdogwpat-gsvougtgsa-n * molecular-weight: ** 88...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P ==
+
== Metabolite CPD-10353 ==
 
* common-name:
 
* common-name:
** phosphoribulosylformimino-aicar-phosphate
+
** (r)-acetoin
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
+
** cc(o)c(=o)c
 
* inchi-key:
 
* inchi-key:
** blkfnhochnclii-ghvqhmavsa-j
+
** rowkjavdogwpat-gsvougtgsa-n
 
* molecular-weight:
 
* molecular-weight:
** 573.303
+
** 88.106
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUTAMIDOTRANS-RXN]]
+
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
* [[RXN-17900]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PRIBFAICARPISOM-RXN]]
+
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
* [[PRICI]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phosphoribulosylformimino-aicar-phosphate}}
+
{{#set: common-name=(r)-acetoin}}
{{#set: inchi-key=inchikey=blkfnhochnclii-ghvqhmavsa-j}}
+
{{#set: inchi-key=inchikey=rowkjavdogwpat-gsvougtgsa-n}}
{{#set: molecular-weight=573.303}}
+
{{#set: molecular-weight=88.106}}

Revision as of 18:57, 14 January 2021

Metabolite CPD-10353

  • common-name:
    • (r)-acetoin
  • smiles:
    • cc(o)c(=o)c
  • inchi-key:
    • rowkjavdogwpat-gsvougtgsa-n
  • molecular-weight:
    • 88.106

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality