Difference between revisions of "CPD-12935"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.21.6-RXN 1.14.21.6-RXN] == * direction: ** left-to-right * common-name: ** 5α-cholest-7-...")
(Created page with "Category:metabolite == Metabolite CPD-12935 == * common-name: ** 4'-apo-β-carotenal * smiles: ** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.21.6-RXN 1.14.21.6-RXN] ==
+
== Metabolite CPD-12935 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 5α-cholest-7-en-3β-ol,nad(p)h:oxygen 5-oxidoreductase
+
** 4'-apo-β-carotenal
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.19.20 ec-1.14.19.20]
+
** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-4186]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CPD-4187]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c]
+
** ftqsfezuhzhoat-brzoagjpsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ00834]]
+
** 482.748
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ11625]]
+
* [[RXN-11989]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=4'-apo-β-carotenal}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=ftqsfezuhzhoat-brzoagjpsa-n}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=482.748}}
−
== Pathway(s) ==
 
−
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
 
−
** '''14''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY66-3]], cholesterol biosynthesis II (via 24,25-dihydrolanosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3]
 
−
** '''12''' reactions found over '''18''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18924 18924]
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18920 18920]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07215 R07215]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=5α-cholest-7-en-3β-ol,nad(p)h:oxygen 5-oxidoreductase}}
 
−
{{#set: ec-number=ec-1.14.19.20}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-12935

  • common-name:
    • 4'-apo-β-carotenal
  • smiles:
    • cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)
  • inchi-key:
    • ftqsfezuhzhoat-brzoagjpsa-n
  • molecular-weight:
    • 482.748

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-12935&oldid=139194"