Difference between revisions of "CPD-12935"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14220 RXN-14220] == * direction: ** left-to-right == Reaction formula == * 1 DUDP[c] '''+''...") |
(Created page with "Category:metabolite == Metabolite CPD-12935 == * common-name: ** 4'-apo-β-carotenal * smiles: ** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-12935 == |
| − | * | + | * common-name: |
| − | ** | + | ** 4'-apo-β-carotenal |
| − | == | + | * smiles: |
| − | + | ** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1) | |
| − | == | + | * inchi-key: |
| − | * | + | ** ftqsfezuhzhoat-brzoagjpsa-n |
| − | ** | + | * molecular-weight: |
| − | ** | + | ** 482.748 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[RXN-11989]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | {{#set: | + | {{#set: common-name=4'-apo-β-carotenal}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=ftqsfezuhzhoat-brzoagjpsa-n}} |
| − | + | {{#set: molecular-weight=482.748}} | |
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-12935
- common-name:
- 4'-apo-β-carotenal
- smiles:
- cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)
- inchi-key:
- ftqsfezuhzhoat-brzoagjpsa-n
- molecular-weight:
- 482.748
