Difference between revisions of "CPD-12936"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROPIONAMIDE == * common-name: ** propionamide * smiles: ** ccc(n)=o * inchi-key: ** qlnjfjadrcogbj-uhfffaoysa-n * molecular-weight: ** 7...")
(Created page with "Category:metabolite == Metabolite CPD-12936 == * common-name: ** apo-4'-lycopenal * smiles: ** cc(c)=cccc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)c=o * inchi-key:...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROPIONAMIDE ==
+
== Metabolite CPD-12936 ==
 
* common-name:
 
* common-name:
** propionamide
+
** apo-4'-lycopenal
 
* smiles:
 
* smiles:
** ccc(n)=o
+
** cc(c)=cccc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)c=o
 
* inchi-key:
 
* inchi-key:
** qlnjfjadrcogbj-uhfffaoysa-n
+
** qpkntqummsiklq-ymwarttesa-n
 
* molecular-weight:
 
* molecular-weight:
** 73.094
+
** 482.748
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14727]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11999]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=propionamide}}
+
{{#set: common-name=apo-4'-lycopenal}}
{{#set: inchi-key=inchikey=qlnjfjadrcogbj-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=qpkntqummsiklq-ymwarttesa-n}}
{{#set: molecular-weight=73.094}}
+
{{#set: molecular-weight=482.748}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-12936

  • common-name:
    • apo-4'-lycopenal
  • smiles:
    • cc(c)=cccc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)c=o
  • inchi-key:
    • qpkntqummsiklq-ymwarttesa-n
  • molecular-weight:
    • 482.748

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality