Difference between revisions of "CPD-12936"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06007 == * transcription-direction: ** positive * right-end-position: ** 56361 * left-end-position: ** 52568 * centisome-position: ** 10.883914...") |
(Created page with "Category:metabolite == Metabolite CPD-12936 == * common-name: ** apo-4'-lycopenal * smiles: ** cc(c)=cccc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)c=o * inchi-key:...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-12936 == |
| − | * | + | * common-name: |
| − | ** | + | ** apo-4'-lycopenal |
| − | + | * smiles: | |
| − | + | ** cc(c)=cccc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)c=o | |
| − | * | + | * inchi-key: |
| − | ** | + | ** qpkntqummsiklq-ymwarttesa-n |
| − | + | * molecular-weight: | |
| − | + | ** 482.748 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[RXN-11999]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=apo-4'-lycopenal}} | |
| − | ** | + | {{#set: inchi-key=inchikey=qpkntqummsiklq-ymwarttesa-n}} |
| − | + | {{#set: molecular-weight=482.748}} | |
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-12936
- common-name:
- apo-4'-lycopenal
- smiles:
- cc(c)=cccc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)c=o
- inchi-key:
- qpkntqummsiklq-ymwarttesa-n
- molecular-weight:
- 482.748
