Difference between revisions of "CPD-12980"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17049 == * common-name: ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))n...")
(Created page with "Category:metabolite == Metabolite CPD-12980 == * common-name: ** an oligosaccharide with 4-deoxy-6-o-methyl-α-d-galact-4-enuronate end == Reaction(s) known to consum...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17049 ==
+
== Metabolite CPD-12980 ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
+
** an oligosaccharide with 4-deoxy-6-o-methyl-α-d-galact-4-enuronate end
* smiles:
 
** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))nc(=o)2)
 
* inchi-key:
 
** vzgsjjjqzptkgr-vxgbxaggsa-n
 
* molecular-weight:
 
** 298.374
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15684]]
+
* [[4.2.2.10-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[4.2.2.10-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=an oligosaccharide with 4-deoxy-6-o-methyl-α-d-galact-4-enuronate end}}
{{#set: inchi-key=inchikey=vzgsjjjqzptkgr-vxgbxaggsa-n}}
 
{{#set: molecular-weight=298.374}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-12980

  • common-name:
    • an oligosaccharide with 4-deoxy-6-o-methyl-α-d-galact-4-enuronate end

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality