Difference between revisions of "CPD-12980"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15675 == * common-name: ** 2-trans-6-trans-tridecadienoyl-coa * smiles: ** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
(Created page with "Category:metabolite == Metabolite Starch == * common-name: ** starch == Reaction(s) known to consume the compound == * 3.2.1.1-RXN * RXN-1823 == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15675 ==
+
== Metabolite Starch ==
 
* common-name:
 
* common-name:
** 2-trans-6-trans-tridecadienoyl-coa
+
** starch
* smiles:
 
** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** oosdlbaxvxkfib-bjbrngjvsa-j
 
* molecular-weight:
 
** 955.803
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14786]]
+
* [[3.2.1.1-RXN]]
 +
* [[RXN-1823]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14785]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans-6-trans-tridecadienoyl-coa}}
+
{{#set: common-name=starch}}
{{#set: inchi-key=inchikey=oosdlbaxvxkfib-bjbrngjvsa-j}}
 
{{#set: molecular-weight=955.803}}
 

Revision as of 18:55, 14 January 2021

Metabolite Starch

  • common-name:
    • starch

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality