Difference between revisions of "CPD-13004"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20902 == * transcription-direction: ** negative * right-end-position: ** 593321 * left-end-position: ** 584350 * centisome-position: ** 95.71694...") |
(Created page with "Category:metabolite == Metabolite BILIVERDINE == * common-name: ** biliverdin-ix-α * smiles: ** c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite BILIVERDINE == |
− | * | + | * common-name: |
− | ** | + | ** biliverdin-ix-α |
− | * | + | * smiles: |
− | ** | + | ** c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o))c(c)=c3ccc([o-])=o))n4)ccc([o-])=o)) |
− | * | + | * inchi-key: |
− | ** | + | ** qbuvfdktzjnupp-msgwkzgbsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 580.639 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[1.3.7.2-RXN]] |
− | == Reaction(s) | + | * [[1.3.7.4-RXN]] |
− | * [[RXN | + | * [[R05818]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] |
− | + | * [[R05818]] | |
− | {{#set: | + | * [[RXN-17523]] |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=biliverdin-ix-α}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=qbuvfdktzjnupp-msgwkzgbsa-l}} |
− | + | {{#set: molecular-weight=580.639}} |
Revision as of 20:31, 18 December 2020
Contents
Metabolite BILIVERDINE
- common-name:
- biliverdin-ix-α
- smiles:
- c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o))c(c)=c3ccc([o-])=o))n4)ccc([o-])=o))
- inchi-key:
- qbuvfdktzjnupp-msgwkzgbsa-l
- molecular-weight:
- 580.639