Difference between revisions of "CPD-1301"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11641 == * common-name: ** 4-methylumbelliferyl glucoside * smiles: ** cc3(c2(c=cc(oc1(oc(co)c(o)c(o)c(o)1))=cc=2oc(=o)c=3)) * inchi-...") |
(Created page with "Category:metabolite == Metabolite CPD-1301 == * common-name: ** tetrahydropteroyl tri-l-glutamate * smiles: ** c([ch]2(nc1(c(nc(=nc=1nc2)n)=o)))nc3(=cc=c(c(nc(c(=o)[o-])cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-1301 == |
* common-name: | * common-name: | ||
| − | ** | + | ** tetrahydropteroyl tri-l-glutamate |
* smiles: | * smiles: | ||
| − | ** | + | ** c([ch]2(nc1(c(nc(=nc=1nc2)n)=o)))nc3(=cc=c(c(nc(c(=o)[o-])ccc(nc(c(=o)[o-])ccc(nc(c(=o)[o-])ccc([o-])=o)=o)=o)=o)c=c3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rxwvhryztwzath-xslagttesa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 699.633 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[HOMOCYSMET-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[HOMOCYSMET-RXN]] | ||
| + | * [[RXN-12730]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tetrahydropteroyl tri-l-glutamate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rxwvhryztwzath-xslagttesa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=699.633}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-1301
- common-name:
- tetrahydropteroyl tri-l-glutamate
- smiles:
- c([ch]2(nc1(c(nc(=nc=1nc2)n)=o)))nc3(=cc=c(c(nc(c(=o)[o-])ccc(nc(c(=o)[o-])ccc(nc(c(=o)[o-])ccc([o-])=o)=o)=o)=o)c=c3)
- inchi-key:
- rxwvhryztwzath-xslagttesa-j
- molecular-weight:
- 699.633
