Difference between revisions of "CPD-13014"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Acyl-Phosphates == * common-name: ** an acyl phosphate == Reaction(s) known to consume the compound == * ACYLPHOSPHATASE-RXN == React...")
(Created page with "Category:metabolite == Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C == * common-name: ** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * smiles: ** cc(o)(co)c(o)cop(op([o-])(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Acyl-Phosphates ==
+
== Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C ==
 
* common-name:
 
* common-name:
** an acyl phosphate
+
** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
 +
* smiles:
 +
** cc(o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
 +
* inchi-key:
 +
** yfaukwznpvbcff-xhibxcghsa-l
 +
* molecular-weight:
 +
** 519.295
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACYLPHOSPHATASE-RXN]]
+
* [[2.7.1.148-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.7.60-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an acyl phosphate}}
+
{{#set: common-name=4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
 +
{{#set: inchi-key=inchikey=yfaukwznpvbcff-xhibxcghsa-l}}
 +
{{#set: molecular-weight=519.295}}

Revision as of 11:15, 15 January 2021

Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C

  • common-name:
    • 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
  • smiles:
    • cc(o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
  • inchi-key:
    • yfaukwznpvbcff-xhibxcghsa-l
  • molecular-weight:
    • 519.295

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality