Difference between revisions of "CPD-13080"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9091 == * smiles: ** cc=c5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4...") |
(Created page with "Category:metabolite == Metabolite RIBOFLAVIN == * common-name: ** riboflavin * smiles: ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RIBOFLAVIN == |
| + | * common-name: | ||
| + | ** riboflavin | ||
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) |
| − | * | + | * inchi-key: |
| − | ** | + | ** aunganrzjhbgpy-scrdcrapsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 375.36 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ARPT]] | ||
| + | * [[NADPH-DEHYDROGENASE-FLAVIN-RXN]] | ||
| + | * [[RIBOFLAVINKIN-RXN]] | ||
| + | * [[RXN-12445]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[RIBOFLAVIN-SYN-RXN]] |
| − | * [[ | + | * [[RXN0-5187]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=riboflavin}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=aunganrzjhbgpy-scrdcrapsa-m}} |
| + | {{#set: molecular-weight=375.36}} | ||
Revision as of 08:28, 15 March 2021
Contents
Metabolite RIBOFLAVIN
- common-name:
- riboflavin
- smiles:
- cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3)))
- inchi-key:
- aunganrzjhbgpy-scrdcrapsa-m
- molecular-weight:
- 375.36
