Difference between revisions of "CPD-13118"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite URIDINE == * common-name: ** uridine * smiles: ** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** drtqhjpvmgbucf-xvfcmesisa-n *...") |
(Created page with "Category:metabolite == Metabolite CPD-13118 == * common-name: ** gdp-β-l-fucose * smiles: ** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-13118 == |
* common-name: | * common-name: | ||
− | ** | + | ** gdp-β-l-fucose |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lqebexmhblqmdb-jgqubwhwsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 587.33 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.4.1.221-RXN]] |
− | + | * [[2.4.1.68-RXN]] | |
− | + | * [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]] | |
− | + | * [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]] | |
− | + | * [[RXN-9463]] | |
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | * [[ | ||
− | * [[ | ||
− | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.1.1.271-RXN]] |
− | * [[ | + | * [[2.4.1.221-RXN]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=gdp-β-l-fucose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lqebexmhblqmdb-jgqubwhwsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=587.33}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-13118
- common-name:
- gdp-β-l-fucose
- smiles:
- cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
- inchi-key:
- lqebexmhblqmdb-jgqubwhwsa-l
- molecular-weight:
- 587.33
Reaction(s) known to consume the compound
- 2.4.1.221-RXN
- 2.4.1.68-RXN
- GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN
- GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN
- RXN-9463