Difference between revisions of "CPD-13118"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cytosine-38-in-tRNAs == * common-name: ** a cytosine38 in trna == Reaction(s) known to consume the compound == * RXN-11855 == Reactio...")
(Created page with "Category:metabolite == Metabolite URIDINE == * common-name: ** uridine * smiles: ** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** drtqhjpvmgbucf-xvfcmesisa-n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cytosine-38-in-tRNAs ==
+
== Metabolite URIDINE ==
 
* common-name:
 
* common-name:
** a cytosine38 in trna
+
** uridine
 +
* smiles:
 +
** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 +
* inchi-key:
 +
** drtqhjpvmgbucf-xvfcmesisa-n
 +
* molecular-weight:
 +
** 244.204
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11855]]
+
* [[AUPT]]
 +
* [[DATUP]]
 +
* [[DCTUP]]
 +
* [[DGTUP]]
 +
* [[DTTUP]]
 +
* [[DUTUP]]
 +
* [[GTUP]]
 +
* [[ITUP]]
 +
* [[URIDINE-NUCLEOSIDASE-RXN]]
 +
* [[URIDINEKIN-RXN]]
 +
* [[URKI-RXN]]
 +
* [[URPHOS-RXN]]
 +
* [[UTUP]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[CYTIDEAM2-RXN]]
 +
* [[RXN-14025]]
 +
* [[UMPP]]
 +
* [[URPHOS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cytosine38 in trna}}
+
{{#set: common-name=uridine}}
 +
{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
 +
{{#set: molecular-weight=244.204}}

Revision as of 15:28, 5 January 2021

Metabolite URIDINE

  • common-name:
    • uridine
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • drtqhjpvmgbucf-xvfcmesisa-n
  • molecular-weight:
    • 244.204

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality