Difference between revisions of "CPD-13122"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Short-Chain-234-Saturated-acyl-CoAs == * common-name: ** a short-chain 2,3,4-saturated fatty acyl coa == Reaction(s) known to consume the...")
(Created page with "Category:metabolite == Metabolite CPD-15677 == * common-name: ** 4-trans-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Short-Chain-234-Saturated-acyl-CoAs ==
+
== Metabolite CPD-15677 ==
 
* common-name:
 
* common-name:
** a short-chain 2,3,4-saturated fatty acyl coa
+
** 4-trans-undecenoyl-coa
 +
* smiles:
 +
** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** afmmiiqkxqnedn-dupkwvsksa-j
 +
* molecular-weight:
 +
** 929.765
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13449]]
+
* [[RXN-14789]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14788]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a short-chain 2,3,4-saturated fatty acyl coa}}
+
{{#set: common-name=4-trans-undecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=afmmiiqkxqnedn-dupkwvsksa-j}}
 +
{{#set: molecular-weight=929.765}}

Revision as of 08:30, 15 March 2021

Metabolite CPD-15677

  • common-name:
    • 4-trans-undecenoyl-coa
  • smiles:
    • ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • afmmiiqkxqnedn-dupkwvsksa-j
  • molecular-weight:
    • 929.765

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality