Difference between revisions of "CPD-13122"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ssRNAs == * common-name: ** a single-stranded rna == Reaction(s) known to consume the compound == * 2.7.7.8-RXN == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite CPD-13122 == * common-name: ** 4-deoxy-l-threo-hex-4-enopyranuronate * smiles: ** c(c1(oc(c(c(c=1)o)o)o))([o-])=o * inchi-key: ** iakkjsv...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ssRNAs ==
+
== Metabolite CPD-13122 ==
 
* common-name:
 
* common-name:
** a single-stranded rna
+
** 4-deoxy-l-threo-hex-4-enopyranuronate
 +
* smiles:
 +
** c(c1(oc(c(c(c=1)o)o)o))([o-])=o
 +
* inchi-key:
 +
** iakkjsvsfctlry-baktxgbysa-m
 +
* molecular-weight:
 +
** 175.118
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.8-RXN]]
+
* [[RXN-16512]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.8-RXN]]
+
* [[RXN-12177]]
 +
* [[RXN-12178]]
 +
* [[RXN-12270]]
 +
* [[RXN-16485]]
 +
* [[RXN-16512]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a single-stranded rna}}
+
{{#set: common-name=4-deoxy-l-threo-hex-4-enopyranuronate}}
 +
{{#set: inchi-key=inchikey=iakkjsvsfctlry-baktxgbysa-m}}
 +
{{#set: molecular-weight=175.118}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-13122

  • common-name:
    • 4-deoxy-l-threo-hex-4-enopyranuronate
  • smiles:
    • c(c1(oc(c(c(c=1)o)o)o))([o-])=o
  • inchi-key:
    • iakkjsvsfctlry-baktxgbysa-m
  • molecular-weight:
    • 175.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality