Difference between revisions of "CPD-13171"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Beta-adrenergic-receptors == * common-name: ** a β-adrenergic receptor == Reaction(s) known to consume the compound == * 2.7.11.15...") |
(Created page with "Category:metabolite == Metabolite CPD-13171 == * common-name: ** 15,9'-di-cis-phytofluene * smiles: ** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c *...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13171 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 15,9'-di-cis-phytofluene |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** ovsvtcfnlsgamm-iqemyqfosa-n | ||
| + | * molecular-weight: | ||
| + | ** 542.93 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12244]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12243]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=15,9'-di-cis-phytofluene}} |
| + | {{#set: inchi-key=inchikey=ovsvtcfnlsgamm-iqemyqfosa-n}} | ||
| + | {{#set: molecular-weight=542.93}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-13171
- common-name:
- 15,9'-di-cis-phytofluene
- smiles:
- cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c
- inchi-key:
- ovsvtcfnlsgamm-iqemyqfosa-n
- molecular-weight:
- 542.93
