Difference between revisions of "CPD-13171"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYOXYLATE-OXIDASE-RXN GLYOXYLATE-OXIDASE-RXN] == * direction: ** left-to-right * common-name: ** g...") |
(Created page with "Category:metabolite == Metabolite CPD-13171 == * common-name: ** 15,9'-di-cis-phytofluene * smiles: ** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c *...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-13171 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 15,9'-di-cis-phytofluene |
− | * | + | * smiles: |
− | ** | + | ** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c |
− | == | + | * inchi-key: |
− | + | ** ovsvtcfnlsgamm-iqemyqfosa-n | |
− | + | * molecular-weight: | |
− | * | + | ** 542.93 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN-12244]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12243]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | == | + | {{#set: common-name=15,9'-di-cis-phytofluene}} |
− | * | + | {{#set: inchi-key=inchikey=ovsvtcfnlsgamm-iqemyqfosa-n}} |
− | + | {{#set: molecular-weight=542.93}} | |
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-13171
- common-name:
- 15,9'-di-cis-phytofluene
- smiles:
- cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c
- inchi-key:
- ovsvtcfnlsgamm-iqemyqfosa-n
- molecular-weight:
- 542.93