Difference between revisions of "CPD-13171"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SALICYLATE-1-MONOOXYGENASE-RXN SALICYLATE-1-MONOOXYGENASE-RXN] == * direction: ** left-to-right * c...")
 
(Created page with "Category:metabolite == Metabolite CPD-13171 == * common-name: ** 15,9'-di-cis-phytofluene * smiles: ** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c *...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SALICYLATE-1-MONOOXYGENASE-RXN SALICYLATE-1-MONOOXYGENASE-RXN] ==
+
== Metabolite CPD-13171 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** salicylate 1-monooxygenase
+
** 15,9'-di-cis-phytofluene
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.14.13.1 ec-1.14.13.1]
+
** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-110]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CATECHOL]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c]
+
** ovsvtcfnlsgamm-iqemyqfosa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ21101]]
+
** 542.93
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-12244]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[PWY-6183]], salicylate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6183 PWY-6183]
+
* [[RXN-12243]]
** '''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
== Reconstruction information  ==
+
{{#set: common-name=15,9'-di-cis-phytofluene}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ovsvtcfnlsgamm-iqemyqfosa-n}}
== External links  ==
+
{{#set: molecular-weight=542.93}}
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11005 11005]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00818 R00818]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P23262 P23262]
 
** [http://www.uniprot.org/uniprot/Q53552 Q53552]
 
** [http://www.uniprot.org/uniprot/Q59700 Q59700]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=salicylate 1-monooxygenase}}
 
{{#set: ec-number=ec-1.14.13.1}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-13171

  • common-name:
    • 15,9'-di-cis-phytofluene
  • smiles:
    • cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c
  • inchi-key:
    • ovsvtcfnlsgamm-iqemyqfosa-n
  • molecular-weight:
    • 542.93

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality