Difference between revisions of "CPD-13171"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYOXYLATE-OXIDASE-RXN GLYOXYLATE-OXIDASE-RXN] == * direction: ** left-to-right * common-name: ** g...")
(Created page with "Category:metabolite == Metabolite CPD-1063 == * common-name: ** 5-(methylthio)ribulose 1-phosphate * smiles: ** cscc(o)c(o)c(=o)cop([o-])(=o)[o-] * inchi-key: ** cnsjryumv...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYOXYLATE-OXIDASE-RXN GLYOXYLATE-OXIDASE-RXN] ==
+
== Metabolite CPD-1063 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** glyoxylate oxidase
+
** 5-(methylthio)ribulose 1-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.2.3.5 ec-1.2.3.5]
+
** cscc(o)c(o)c(=o)cop([o-])(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[GLYOX]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[OXALATE]][c] '''+''' 1 [[PROTON]][c]
+
** cnsjryumvmwnmc-ritpcoansa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ20716]]
+
** 258.182
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[R145-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[5.3.1.23-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[M5TRPI]]
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
* RHEA:
+
{{#set: common-name=5-(methylthio)ribulose 1-phosphate}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14837 14837]
+
{{#set: inchi-key=inchikey=cnsjryumvmwnmc-ritpcoansa-l}}
−
* LIGAND-RXN:
+
{{#set: molecular-weight=258.182}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R00466 R00466]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=glyoxylate oxidase}}
 
−
{{#set: ec-number=ec-1.2.3.5}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-1063

  • common-name:
    • 5-(methylthio)ribulose 1-phosphate
  • smiles:
    • cscc(o)c(o)c(=o)cop([o-])(=o)[o-]
  • inchi-key:
    • cnsjryumvmwnmc-ritpcoansa-l
  • molecular-weight:
    • 258.182

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13171&oldid=47983"