Difference between revisions of "CPD-13171"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1063 == * common-name: ** 5-(methylthio)ribulose 1-phosphate * smiles: ** cscc(o)c(o)c(=o)cop([o-])(=o)[o-] * inchi-key: ** cnsjryumv...") |
(Created page with "Category:metabolite == Metabolite CPD-8773 == * common-name: ** 4-methylbenzaldehyde * smiles: ** cc1(c=cc(c=o)=cc=1) * inchi-key: ** fxlovshxalflkq-uhfffaoysa-n * molecul...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-8773 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-methylbenzaldehyde |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(c=cc(c=o)=cc=1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** fxlovshxalflkq-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 120.151 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-8582]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-methylbenzaldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fxlovshxalflkq-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=120.151}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-8773
- common-name:
- 4-methylbenzaldehyde
- smiles:
- cc1(c=cc(c=o)=cc=1)
- inchi-key:
- fxlovshxalflkq-uhfffaoysa-n
- molecular-weight:
- 120.151