Difference between revisions of "CPD-13171"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYOXYLATE-OXIDASE-RXN GLYOXYLATE-OXIDASE-RXN] == * direction: ** left-to-right * common-name: ** g...")
(Created page with "Category:metabolite == Metabolite CPD-13171 == * common-name: ** 15,9'-di-cis-phytofluene * smiles: ** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c *...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYOXYLATE-OXIDASE-RXN GLYOXYLATE-OXIDASE-RXN] ==
+
== Metabolite CPD-13171 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** glyoxylate oxidase
+
** 15,9'-di-cis-phytofluene
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.2.3.5 ec-1.2.3.5]
+
** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[GLYOX]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[OXALATE]][c] '''+''' 1 [[PROTON]][c]
+
** ovsvtcfnlsgamm-iqemyqfosa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ20716]]
+
** 542.93
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-12244]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[RXN-12243]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=15,9'-di-cis-phytofluene}}
−
* RHEA:
+
{{#set: inchi-key=inchikey=ovsvtcfnlsgamm-iqemyqfosa-n}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14837 14837]
+
{{#set: molecular-weight=542.93}}
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00466 R00466]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=glyoxylate oxidase}}
 
−
{{#set: ec-number=ec-1.2.3.5}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-13171

  • common-name:
    • 15,9'-di-cis-phytofluene
  • smiles:
    • cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c
  • inchi-key:
    • ovsvtcfnlsgamm-iqemyqfosa-n
  • molecular-weight:
    • 542.93

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13171&oldid=139167"