Difference between revisions of "CPD-13172"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OHyW-58-tRNAPhe == * common-name: ** 7-[4-methoxy-(2-hydroxy-3-amino-3-carboxypropyl)]-wyosine37 in trnaphe == Reaction(s) known to consu...") |
(Created page with "Category:metabolite == Metabolite CPD-13172 == * common-name: ** 6-hydroxy-2-cyclohexen-one-carboxylate * smiles: ** c(=o)(c1(o)(c=cccc(=o)1))[o-] * inchi-key: ** wezwwzku...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13172 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-hydroxy-2-cyclohexen-one-carboxylate |
| + | * smiles: | ||
| + | ** c(=o)(c1(o)(c=cccc(=o)1))[o-] | ||
| + | * inchi-key: | ||
| + | ** wezwwzkubqcmbl-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 155.13 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12252]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-hydroxy-2-cyclohexen-one-carboxylate}} |
| + | {{#set: inchi-key=inchikey=wezwwzkubqcmbl-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=155.13}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-13172
- common-name:
- 6-hydroxy-2-cyclohexen-one-carboxylate
- smiles:
- c(=o)(c1(o)(c=cccc(=o)1))[o-]
- inchi-key:
- wezwwzkubqcmbl-uhfffaoysa-m
- molecular-weight:
- 155.13
