Difference between revisions of "CPD-13172"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-343 RXN66-343] == * direction: ** left-to-right * common-name: ** testosterone reductase ** t...")
(Created page with "Category:metabolite == Metabolite CPD-13172 == * common-name: ** 6-hydroxy-2-cyclohexen-one-carboxylate * smiles: ** c(=o)(c1(o)(c=cccc(=o)1))[o-] * inchi-key: ** wezwwzku...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-343 RXN66-343] ==
+
== Metabolite CPD-13172 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** testosterone reductase
+
** 6-hydroxy-2-cyclohexen-one-carboxylate
** testosterone 5α-reductase
+
* smiles:
* ec-number:
+
** c(=o)(c1(o)(c=cccc(=o)1))[o-]
** [http://enzyme.expasy.org/EC/1.3.1.22 ec-1.3.1.22]
+
* inchi-key:
== Reaction formula ==
+
** wezwwzkubqcmbl-uhfffaoysa-m
* 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[TESTOSTERONE]][c] '''=>''' 1 [[17-BETA-HYDROXY-5ALPHA-ANDROSTAN-3-O]][c] '''+''' 1 [[NADP]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 155.13
* Gene: [[SJ20675]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-12252]]
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
* [[PWY66-378]], androgen biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-378 PWY66-378]
+
{{#set: common-name=6-hydroxy-2-cyclohexen-one-carboxylate}}
** '''3''' reactions found over '''6''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=wezwwzkubqcmbl-uhfffaoysa-m}}
== Reconstruction information  ==
+
{{#set: molecular-weight=155.13}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=testosterone 5α-reductase|testosterone reductase}}
 
{{#set: ec-number=ec-1.3.1.22}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-13172

  • common-name:
    • 6-hydroxy-2-cyclohexen-one-carboxylate
  • smiles:
    • c(=o)(c1(o)(c=cccc(=o)1))[o-]
  • inchi-key:
    • wezwwzkubqcmbl-uhfffaoysa-m
  • molecular-weight:
    • 155.13

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality