Difference between revisions of "CPD-13172"

Revision as of 15:28, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-17894 ==
+== Metabolite Uracil17-in-tRNAs ==
 * common-name:
-** &beta;-d-mannosyl-(c55 &omega;-saturated dolichyl phosphate)
+** a uracil17 in trna
-* smiles:
-** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])oc1(oc(co)c(o)c(o)c(o)1))c
-* inchi-key:
-** mbyvktiiznuhkn-nivaaieqsa-m
-* molecular-weight:
-** 1012.461
 == Reaction(s) known to consume the compound ==
+* [[RXN-12455]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-16602]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=&beta;-d-mannosyl-(c55 &omega;-saturated dolichyl phosphate)}}
+{{#set: common-name=a uracil17 in trna}}
-{{#set: inchi-key=inchikey=mbyvktiiznuhkn-nivaaieqsa-m}}
-{{#set: molecular-weight=1012.461}}