Difference between revisions of "CPD-13172"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Uracil17-in-tRNAs == * common-name: ** a uracil17 in trna == Reaction(s) known to consume the compound == * RXN-12455 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite INDOLE-3-GLYCEROL-P == * common-name: ** (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite INDOLE-3-GLYCEROL-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate |
| + | * smiles: | ||
| + | ** c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o)[o-])o)o) | ||
| + | * inchi-key: | ||
| + | ** nqeqtypjsiephw-mnovxskesa-l | ||
| + | * molecular-weight: | ||
| + | ** 285.193 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[RXN0-2381]] |
| + | * [[TRYPSYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[IGPSYN-RXN]] | ||
| + | * [[RXN0-2381]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate}} |
| + | {{#set: inchi-key=inchikey=nqeqtypjsiephw-mnovxskesa-l}} | ||
| + | {{#set: molecular-weight=285.193}} | ||
Revision as of 13:11, 14 January 2021
Contents
Metabolite INDOLE-3-GLYCEROL-P
- common-name:
- (1s,2r)-1-c-(indol-3-yl)glycerol 3-phosphate
- smiles:
- c2(=c(c1(c=cc=cc=1n2))c(c(cop([o-])(=o)[o-])o)o)
- inchi-key:
- nqeqtypjsiephw-mnovxskesa-l
- molecular-weight:
- 285.193
