Difference between revisions of "CPD-13187"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13403 == * common-name: ** l-alanyl-l-glutamine * smiles: ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n * inchi-key: ** hjcmdxdypoufdy-whfbia...") |
(Created page with "Category:metabolite == Metabolite CPD-13187 == * common-name: ** unsaturated gellan tetrasaccharide * smiles: ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13187 == |
* common-name: | * common-name: | ||
| − | ** | + | ** unsaturated gellan tetrasaccharide |
* smiles: | * smiles: | ||
| − | ** | + | ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jmdplhpaglyhci-pqvubfrasa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 645.544 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12270]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=unsaturated gellan tetrasaccharide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jmdplhpaglyhci-pqvubfrasa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=645.544}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-13187
- common-name:
- unsaturated gellan tetrasaccharide
- smiles:
- cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4)))
- inchi-key:
- jmdplhpaglyhci-pqvubfrasa-m
- molecular-weight:
- 645.544
