Difference between revisions of "CPD-13188"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-Ketoglutaryl-ACP-methyl-ester == * common-name: ** a 3-oxo-glutaryl-[acp] methyl ester == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite CPD-13188 == * common-name: ** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp * smiles: ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13188 == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp |
| + | * smiles: | ||
| + | ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o)) | ||
| + | * inchi-key: | ||
| + | ** cwvrqjbcbctflt-civpzrojsa-n | ||
| + | * molecular-weight: | ||
| + | ** 488.442 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12270]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp}} |
| + | {{#set: inchi-key=inchikey=cwvrqjbcbctflt-civpzrojsa-n}} | ||
| + | {{#set: molecular-weight=488.442}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-13188
- common-name:
- β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp
- smiles:
- cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o))
- inchi-key:
- cwvrqjbcbctflt-civpzrojsa-n
- molecular-weight:
- 488.442
