Difference between revisions of "CPD-13205"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-adenine-37 == * common-name: ** an adenine37 in trna == Reaction(s) known to consume the compound == * RXN-14570 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-611 == * common-name: ** thiamine triphosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-611 == |
* common-name: | * common-name: | ||
| − | ** | + | ** thiamine triphosphate |
| + | * smiles: | ||
| + | ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) | ||
| + | * inchi-key: | ||
| + | ** iwlrowzyzpnofc-uhfffaoysa-k | ||
| + | * molecular-weight: | ||
| + | ** 501.26 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[THIAMIN-TRIPHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thiamine triphosphate}} |
| + | {{#set: inchi-key=inchikey=iwlrowzyzpnofc-uhfffaoysa-k}} | ||
| + | {{#set: molecular-weight=501.26}} | ||
Revision as of 08:28, 15 March 2021
Contents
Metabolite CPD-611
- common-name:
- thiamine triphosphate
- smiles:
- cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
- inchi-key:
- iwlrowzyzpnofc-uhfffaoysa-k
- molecular-weight:
- 501.26
